CAS 88671-71-0
:N-[(dibenzylamino)(phenyl)methyl]benzamide
Description:
N-[(Dibenzylamino)(phenyl)methyl]benzamide, with the CAS number 88671-71-0, is an organic compound characterized by its complex structure, which includes a benzamide moiety and a dibenzylamino group. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential for hydrogen bonding due to the presence of the amide functional group. The dibenzylamino group contributes to its lipophilicity, which may enhance its ability to interact with biological membranes. The presence of multiple aromatic rings in its structure suggests that it may exhibit significant π-π stacking interactions, which can influence its stability and reactivity. Additionally, compounds of this nature may possess interesting pharmacological properties, making them of interest in medicinal chemistry. However, specific physical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization. Overall, N-[(dibenzylamino)(phenyl)methyl]benzamide represents a class of compounds that may have diverse applications in chemical research and drug development.
Formula:C28H26N2O
InChI:InChI=1/C28H26N2O/c31-28(26-19-11-4-12-20-26)29-27(25-17-9-3-10-18-25)30(21-23-13-5-1-6-14-23)22-24-15-7-2-8-16-24/h1-20,27H,21-22H2,(H,29,31)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
