CAS 886713-07-1
:N-(4-aminophenyl)-3-phenylpropanamide
Description:
N-(4-aminophenyl)-3-phenylpropanamide, identified by its CAS number 886713-07-1, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a phenyl group and an amino group attached to a propanamide backbone, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like this can exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which may lead to applications in drug development. Additionally, the compound's stability, melting point, and solubility in different solvents would depend on its specific molecular interactions and the presence of substituents. Overall, N-(4-aminophenyl)-3-phenylpropanamide represents a class of compounds that may have significant implications in therapeutic research and development.
Formula:C15H16N2O
InChI:InChI=1/C15H16N2O/c16-13-7-9-14(10-8-13)17-15(18)11-6-12-4-2-1-3-5-12/h1-5,7-10H,6,11,16H2,(H,17,18)
SMILES:c1ccc(cc1)CCC(=O)Nc1ccc(cc1)N
Synonyms:- benzenepropanamide, N-(4-aminophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.