CymitQuimica logo

CAS 886745-59-1

:

5-methoxy-4-nitro-1,3-benzothiazole-2-carboxylic acid

Description:
5-Methoxy-4-nitro-1,3-benzothiazole-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzothiazole ring, a methoxy group, and a nitro substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxy group can influence its solubility and polarity, while the nitro group may impart additional reactivity, particularly in electrophilic substitution reactions. The carboxylic acid functional group contributes to its acidity and can participate in hydrogen bonding, affecting its interactions in various chemical environments. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in synthesizing other complex molecules. Its specific applications and behavior in reactions would depend on the context of use, including solvent interactions and the presence of other reagents.
Formula:C9H6N2O5S
InChI:InChI=1/C9H6N2O5S/c1-16-4-2-3-5-6(7(4)11(14)15)10-8(17-5)9(12)13/h2-3H,1H3,(H,12,13)
Synonyms:
  • Benzothiazole, 5-methoxy-4-nitro-2-carboxylic acid
  • 2-Benzothiazolecarboxylic acid, 5-methoxy-4-nitro-
  • 5-methoxy-4-nitro-1,3-benzothiazole-2-carboxylic acid
  • 5-methoxy-4-nitrobenzo[d]thiazole-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.