CymitQuimica logo

CAS 886759-47-3

:

1-Cyclobutyl-1,2,3,4-tetrahydroisoquinoline

Description:
1-Cyclobutyl-1,2,3,4-tetrahydroisoquinoline is a bicyclic organic compound characterized by its unique structure, which includes a cyclobutyl group attached to a tetrahydroisoquinoline framework. This compound features a nitrogen atom within a saturated ring system, contributing to its potential biological activity. The presence of the cyclobutyl moiety may influence its steric and electronic properties, potentially affecting its interactions with biological targets. Typically, tetrahydroisoquinolines are known for their diverse pharmacological activities, including effects on the central nervous system. The compound's solubility, stability, and reactivity can vary based on its molecular structure and the presence of functional groups. As with many organic compounds, its behavior in different environments, such as solvents or biological systems, can be significant for its applications in medicinal chemistry or material science. Further studies would be necessary to elucidate its specific properties, including its synthesis, reactivity, and potential therapeutic uses.
Formula:C13H17N
InChI:InChI=1/C13H17N/c1-2-7-12-10(4-1)8-9-14-13(12)11-5-3-6-11/h1-2,4,7,11,13-14H,3,5-6,8-9H2
SMILES:c1ccc2c(c1)CCNC2C1CCC1
Synonyms:
  • Isoquinoline, 1-Cyclobutyl-1,2,3,4-Tetrahydro-
  • 1-Cyclobutyl-1,2,3,4-tetrahydroisoquinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.