CymitQuimica logo

CAS 886761-61-1

:

2-Fluoro-4-methylbenzamide

Description:
2-Fluoro-4-methylbenzamide is an organic compound characterized by the presence of a fluorine atom and a methyl group attached to a benzene ring, along with an amide functional group. Its molecular structure consists of a benzene ring substituted at the 2-position with a fluorine atom and at the 4-position with a methyl group, which influences its chemical reactivity and physical properties. The amide functional group contributes to its ability to form hydrogen bonds, enhancing its solubility in polar solvents. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its fluorine substitution can impart unique electronic properties, potentially affecting its reactivity in various chemical reactions. 2-Fluoro-4-methylbenzamide may be utilized in pharmaceutical research and development due to its potential biological activity, although specific applications would depend on further studies. As with many organic compounds, safety data should be consulted to understand its handling and toxicity.
Formula:C8H8FNO
InChI:InChI=1S/C8H8FNO/c1-5-2-3-6(8(10)11)7(9)4-5/h2-4H,1H3,(H2,10,11)
InChI key:InChIKey=PLKJXPACQBBJDC-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(F)C=C(C)C=C1
Synonyms:
  • Benzamide, 2-fluoro-4-methyl-
  • 2-Fluoro-4-methylbenzamide
Found 5 products.