CAS 886762-46-5

4′-Iodo-3,5-bis(trifluoromethyl)-1,1′-biphenyl

Description:

4′-Iodo-3,5-bis(trifluoromethyl)-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of iodine at the para position and two trifluoromethyl groups at the meta positions significantly influences its chemical properties. This compound is typically a solid at room temperature and exhibits high thermal stability due to the strong carbon-fluorine bonds in the trifluoromethyl groups. Its molecular structure contributes to its potential applications in various fields, including materials science and organic electronics, where it may serve as a building block for more complex molecules or as a component in electronic devices. The presence of the iodine atom can also enhance its reactivity in substitution reactions, while the trifluoromethyl groups can impart unique electronic properties. Overall, 4′-Iodo-3,5-bis(trifluoromethyl)-1,1′-biphenyl is notable for its distinctive functional groups and potential utility in advanced chemical applications.

Formula: C₁₄H₇F₆I

InChI: InChI=1S/C14H7F6I/c15-13(16,17)10-5-9(6-11(7-10)14(18,19)20)8-1-3-12(21)4-2-8/h1-7H

InChI key: InChIKey=XTJJSOHOYCCQGJ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=C(C(F)(F)F)C1)C2=CC=C(I)C=C2

Synonyms:

• 4′-Iodo-3,5-bis(trifluoromethyl)-1,1′-biphenyl
• 1,1′-Biphenyl, 4′-iodo-3,5-bis(trifluoromethyl)-

4-[3,5-Bis(trifluoromethyl)phenyl]iodobenzene

CAS: 886762-46-5

4-[3,5-Bis(trifluoromethyl)phenyl]iodobenzene

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 416.10g/mol

Ref: 54-PC7691