CAS 886762-60-3

2-Bromo-6-fluorobenzenesulfonamide

Description:

2-Bromo-6-fluorobenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring that is further substituted with both bromine and fluorine atoms. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. The presence of the bromine and fluorine substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The sulfonamide group imparts unique properties, such as potential antibacterial activity and the ability to form hydrogen bonds, which can enhance its interactions in biological systems. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization. Overall, 2-Bromo-6-fluorobenzenesulfonamide is of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.

Formula: C₆H₅BrFNO₂S

InChI: InChI=1S/C6H5BrFNO2S/c7-4-2-1-3-5(8)6(4)12(9,10)11/h1-3H,(H2,9,10,11)

InChI key: InChIKey=KULOQVSGKICQDT-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(Br)C=CC=C1F

Synonyms:

• 2-Bromo-6-fluorobenzenesulfonamide
• Benzenesulfonamide, 2-bromo-6-fluoro-
• 2-Bromo-6-fluorobenzene-1-sulfonamide

2-Bromo-6-fluorobenzenesulphonamide

CAS: 886762-60-3

2-Bromo-6-fluorobenzenesulphonamide

Formula: C₆H₅BrFNO₂S

Purity: ≥95%

Color and Shape: off white (hint of peach/lemon). fine crystalline powder

Molecular weight: 254.08g/mol

Ref: 54-PC10330