CymitQuimica logo

CAS 886762-72-7

:

5,6-Dichloro-1,2,3,4-tetrahydro-1-naphthalenamine

Description:
5,6-Dichloro-1,2,3,4-tetrahydro-1-naphthalenamine is an organic compound characterized by its naphthalene-derived structure, which features a tetrahydro configuration and two chlorine substituents at the 5 and 6 positions. This compound is typically a solid at room temperature and exhibits properties common to amines, such as basicity and the ability to form hydrogen bonds. The presence of chlorine atoms enhances its reactivity and can influence its solubility in various solvents. The tetrahydro structure contributes to its potential applications in pharmaceuticals and agrochemicals, as it may serve as an intermediate in the synthesis of more complex molecules. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 5,6-Dichloro-1,2,3,4-tetrahydro-1-naphthalenamine is a compound of interest due to its structural features and potential applications in various chemical fields.
Formula:C10H11Cl2N
InChI:InChI=1S/C10H11Cl2N/c11-8-5-4-6-7(10(8)12)2-1-3-9(6)13/h4-5,9H,1-3,13H2
InChI key:InChIKey=MWBLTXQYXDMWTF-UHFFFAOYSA-N
SMILES:ClC1=C2C(C(N)CCC2)=CC=C1Cl
Synonyms:
  • 1-Naphthalenamine, 5,6-dichloro-1,2,3,4-tetrahydro-
  • 5,6-Dichloro-1,2,3,4-tetrahydro-1-naphthalenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.