CAS 886762-81-8

2-Bromo-1-(2,3,6-trifluorophenyl)ethanone

Description:

2-Bromo-1-(2,3,6-trifluorophenyl)ethanone is an organic compound characterized by its bromine and trifluoromethyl substituents, which significantly influence its chemical properties and reactivity. The presence of the bromine atom introduces a halogen, enhancing the compound's electrophilic character, while the trifluorophenyl group contributes to its lipophilicity and potential biological activity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in organic solvents, reflecting its non-polar characteristics, and may exhibit moderate stability under standard conditions. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where halogenated compounds are often utilized for their unique reactivity and biological properties. Additionally, the trifluoromethyl group can enhance metabolic stability and influence the compound's interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Bromo-1-(2,3,6-trifluorophenyl)ethanone is a notable compound in synthetic organic chemistry with diverse applications.

Formula: C₈H₄BrF₃O

InChI: InChI=1S/C8H4BrF3O/c9-3-6(13)7-4(10)1-2-5(11)8(7)12/h1-2H,3H2

InChI key: InChIKey=QHDMYLKOXLOJJY-UHFFFAOYSA-N

SMILES: C(CBr)(=O)C1=C(F)C(F)=CC=C1F

Synonyms:

• 2-Bromo-1-(2,3,6-trifluorophenyl)ethanone
• Ethanone, 2-bromo-1-(2,3,6-trifluorophenyl)-
• 2,3,6-Trifluorophenacyl bromide

2,3,6-Trifluorophenacyl bromide

CAS: 886762-81-8

2,3,6-Trifluorophenacyl bromide

Formula: C₈H₄BrF₃O

Purity: ≥95%

Color and Shape: off white to light yellow fused solid

Molecular weight: 253.02g/mol

Ref: 54-PC10426