CAS 886762-90-9

6,7-Dichloro-3,4-dihydro-2H-1-benzopyran-4-amine

Description:

6,7-Dichloro-3,4-dihydro-2H-1-benzopyran-4-amine is a chemical compound characterized by its unique bicyclic structure, which includes a benzopyran moiety. This compound features two chlorine atoms at the 6 and 7 positions of the benzopyran ring, contributing to its reactivity and potential biological activity. The presence of an amine group at the 4-position enhances its solubility in polar solvents and may influence its interaction with biological targets. The dihydro configuration indicates that the compound has a saturated bond within the bicyclic structure, which can affect its stability and reactivity. This compound is of interest in medicinal chemistry and pharmacology due to its potential applications in drug development, particularly in the context of targeting specific biological pathways. Its molecular properties, such as melting point, boiling point, and solubility, would be essential for understanding its behavior in various environments and its suitability for specific applications. As with many chemical substances, safety and handling precautions are necessary due to the presence of chlorine atoms, which can pose hazards.

Formula: C₉H₉Cl₂NO

InChI: InChI=1S/C9H9Cl2NO/c10-6-3-5-8(12)1-2-13-9(5)4-7(6)11/h3-4,8H,1-2,12H2

InChI key: InChIKey=DBMTUJCOCFPESV-UHFFFAOYSA-N

SMILES: NC1C=2C(=CC(Cl)=C(Cl)C2)OCC1

Synonyms:

• 6,7-Dichloro-3,4-dihydro-2H-1-benzopyran-4-amine
• 2H-1-Benzopyran-4-amine, 6,7-dichloro-3,4-dihydro-
• 6,7-dichloro-3,4-dihydro-2H-chromen-4-amine
• 6,7-DICHLORO-CHROMAN-4-YLAMINE
• 6,7-Dichlorochroman-4-amine