CAS 886763-00-4

3-Bromo-N-methylbenzenepropanamine

Description:

3-Bromo-N-methylbenzenepropanamine, identified by its CAS number 886763-00-4, is an organic compound that features a bromine atom attached to a benzene ring, along with a propanamine side chain. This compound is characterized by its amine functional group, which typically imparts basic properties and the ability to form hydrogen bonds. The presence of the bromine atom introduces both steric and electronic effects, potentially influencing the compound's reactivity and interaction with biological systems. The N-methyl group enhances lipophilicity, which may affect its solubility in organic solvents and biological membranes. As a substituted amine, it may exhibit properties relevant to medicinal chemistry, including potential pharmacological activity. The compound's structure suggests it could participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest in synthetic organic chemistry. However, specific safety and handling information should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₀H₁₄BrN

InChI: InChI=1S/C10H14BrN/c1-12-7-3-5-9-4-2-6-10(11)8-9/h2,4,6,8,12H,3,5,7H2,1H3

InChI key: InChIKey=DGFQHUKUNIXVRQ-UHFFFAOYSA-N

SMILES: C(CCNC)C1=CC(Br)=CC=C1

Synonyms:

• Benzenepropanamine, 3-bromo-N-methyl-
• 3-Bromo-N-methylbenzenepropanamine