CymitQuimica logo

CAS 886763-09-3

:

2-Methyl-4-(trifluoromethoxy)benzeneacetonitrile

Description:
2-Methyl-4-(trifluoromethoxy)benzeneacetonitrile, with the CAS number 886763-09-3, is an organic compound characterized by its aromatic structure and the presence of both a nitrile and a trifluoromethoxy functional group. This compound features a benzene ring substituted with a methyl group and a trifluoromethoxy group, which significantly influences its chemical properties, including polarity and reactivity. The trifluoromethoxy group enhances the compound's electron-withdrawing characteristics, making it potentially useful in various chemical reactions and applications, such as in pharmaceuticals or agrochemicals. The presence of the acetonitrile group contributes to its solubility in polar solvents and may affect its interaction with biological systems. Additionally, the compound's unique structure may impart specific physical properties, such as boiling and melting points, which are essential for its handling and application in laboratory settings. Overall, 2-Methyl-4-(trifluoromethoxy)benzeneacetonitrile is a compound of interest in synthetic organic chemistry due to its distinctive functional groups and potential utility in various chemical processes.
Formula:C10H8F3NO
InChI:InChI=1S/C10H8F3NO/c1-7-6-9(15-10(11,12)13)3-2-8(7)4-5-14/h2-3,6H,4H2,1H3
InChI key:InChIKey=YQTMGMGJQACTFN-UHFFFAOYSA-N
SMILES:C(C#N)C1=C(C)C=C(OC(F)(F)F)C=C1
Synonyms:
  • Benzeneacetonitrile, 2-methyl-4-(trifluoromethoxy)-
  • 2-Methyl-4-(trifluoromethoxy)benzeneacetonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.