CAS 886763-37-7

2-(3,5-Difluorophenoxy)-1-propanamine

Description:

2-(3,5-Difluorophenoxy)-1-propanamine is an organic compound characterized by its unique structure, which includes a propanamine backbone substituted with a 3,5-difluorophenoxy group. This compound features a phenyl ring with two fluorine atoms positioned at the 3 and 5 positions, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the amino group (-NH2) on the propanamine chain suggests that it may exhibit basic properties, allowing it to participate in hydrogen bonding and interact with various biological targets. The fluorine substituents can also affect the compound's electronic properties, stability, and reactivity. Typically, such compounds are of interest in medicinal chemistry and drug development due to their potential pharmacological effects. The specific interactions and applications of 2-(3,5-Difluorophenoxy)-1-propanamine would depend on its biological context, including its mechanism of action and target receptors. As with many fluorinated compounds, it may also exhibit unique solubility and permeability characteristics, making it a candidate for further research in therapeutic applications.

Formula: C₉H₁₁F₂NO

InChI: InChI=1S/C9H11F2NO/c1-6(5-12)13-9-3-7(10)2-8(11)4-9/h2-4,6H,5,12H2,1H3

InChI key: InChIKey=KCEUNSVESUZARK-UHFFFAOYSA-N

SMILES: O(C(CN)C)C1=CC(F)=CC(F)=C1

Synonyms:

• 1-Propanamine, 2-(3,5-difluorophenoxy)-
• 2-(3,5-Difluorophenoxy)-1-propanamine