CAS 886763-58-2

2-[(6-Methyl-3-pyridinyl)oxy]-1-propanamine

Description:

2-[(6-Methyl-3-pyridinyl)oxy]-1-propanamine, identified by its CAS number 886763-58-2, is a chemical compound characterized by its unique structure that includes a propanamine backbone and a pyridine ring substituted with a methyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amino group. The pyridine moiety contributes to its potential biological activity, as pyridine derivatives are often found in pharmaceuticals and agrochemicals. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological targets. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions, given the role of pyridine derivatives in such therapies. Overall, 2-[(6-Methyl-3-pyridinyl)oxy]-1-propanamine is a compound of interest for further research in both synthetic and medicinal chemistry contexts.

Formula: C₉H₁₄N₂O

InChI: InChI=1S/C9H14N2O/c1-7-3-4-9(6-11-7)12-8(2)5-10/h3-4,6,8H,5,10H2,1-2H3

InChI key: InChIKey=XRBLHDYFMYBHJK-UHFFFAOYSA-N

SMILES: O(C(CN)C)C=1C=CC(C)=NC1

Synonyms:

• 1-Propanamine, 2-[(6-methyl-3-pyridinyl)oxy]-
• 2-[(6-Methyl-3-pyridinyl)oxy]-1-propanamine

2-[(6-Methylpyridin-3-yl)oxy]propan-1-amine

CAS: 886763-58-2

Versatile small molecule scaffold

Formula: C₉H₁₄N₂O

Purity: Min. 95%

Molecular weight: 166.22 g/mol

Ref: 3D-LKB76358