CymitQuimica logo

CAS 886763-62-8

:

2-(6-Quinolinyloxy)-1-propanamine

Description:
2-(6-Quinolinyloxy)-1-propanamine, identified by its CAS number 886763-62-8, is a chemical compound characterized by its unique structure that includes a quinoline moiety linked to a propanamine group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its solubility, reactivity, and biological activity. The presence of the quinoline ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinoline derivatives are known for their diverse biological activities, including antimicrobial and antitumor properties. The propanamine portion of the molecule may contribute to its ability to interact with biological targets, such as receptors or enzymes. Additionally, the compound's functional groups can affect its polarity and interaction with solvents, impacting its behavior in various chemical environments. Overall, 2-(6-Quinolinyloxy)-1-propanamine represents a compound of interest in both synthetic and medicinal chemistry, warranting further investigation into its properties and potential applications.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c1-9(8-13)15-11-4-5-12-10(7-11)3-2-6-14-12/h2-7,9H,8,13H2,1H3
InChI key:InChIKey=QKOZNFVLPMVFRQ-UHFFFAOYSA-N
SMILES:O(C(CN)C)C1=CC2=C(C=C1)N=CC=C2
Synonyms:
  • 1-Propanamine, 2-(6-quinolinyloxy)-
  • 2-(6-Quinolinyloxy)-1-propanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.