CAS 886766-28-5
:tert-butyl 4,7-diazaspiro[2.5]octane-7-carboxylate
Description:
Tert-butyl 4,7-diazaspiro[2.5]octane-7-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework featuring nitrogen atoms. This compound typically exhibits properties associated with spiro compounds, such as potential chirality and unique steric interactions due to its three-dimensional arrangement. The presence of the tert-butyl group contributes to its hydrophobic characteristics, while the carboxylate functional group can impart polar properties, influencing solubility and reactivity. The diaza component indicates the presence of two nitrogen atoms within the spiro structure, which may participate in hydrogen bonding and coordination chemistry. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and structural versatility. Its CAS number, 886766-28-5, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, tert-butyl 4,7-diazaspiro[2.5]octane-7-carboxylate represents a fascinating subject for further research in various chemical fields.
Formula:C11H20N2O2
InChI:InChI=1/C11H20N2O2/c1-10(2,3)15-9(14)13-7-6-12-11(8-13)4-5-11/h12H,4-8H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCNC2(CC2)C1
Synonyms:- tert-Butyl-4,7-diazaspiro[2.5]octan-7-carboxylat
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4,7-Diaza-spiro[2.5]octane-7-carboxylic acid tert-butyl ester
CAS:Formula:C11H20N2O2Purity:95%Color and Shape:LiquidMolecular weight:212.28874,7-Diaza-spiro(2.5)octane-7-carboxylic acid tert-butyl ester
CAS:4,7-Diaza-spiro(2.5)octane-7-carboxylic acid tert-butyl esterFormula:C11H20N2O2Purity:95%Color and Shape: colourless to light yellow liquidMolecular weight:212.29g/moltert-Butyl 4,7-Diazaspiro[2.5]octane-7-carboxylate
CAS:Formula:C11H20N2O2Purity:>98.0%(GC)(qNMR)Color and Shape:White to Light yellow powder to lumpMolecular weight:212.29tert-Butyl 4,7-diazaspiro[2.5]octane-7-carboxylate
CAS:Formula:C11H20N2O2Purity:95%Color and Shape:LiquidMolecular weight:212.293tert-Butyl 4,7-diazaspiro[2.5]octane-7-carboxylate
CAS:Controlled ProductFormula:C11H20N2O2Color and Shape:NeatMolecular weight:212.289tert-Butyl 4,7-diazaspiro[2.5]octane-7-carboxylate
CAS:Please enquire for more information about tert-Butyl 4,7-diazaspiro[2.5]octane-7-carboxylate including the price, delivery time and more detailed product information at the technical inquiry form on this pagePurity:Min. 95%





