CAS 886769-95-5

tert-butyl 3-(1,3-benzodioxol-5-yl)piperazine-1-carboxylate

Description:

Tert-butyl 3-(1,3-benzodioxol-5-yl)piperazine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperazine ring, a tert-butyl group, and a benzodioxole moiety. This compound typically exhibits properties associated with both piperazine derivatives and aromatic compounds, such as moderate solubility in organic solvents and potential bioactivity. The presence of the benzodioxole group may contribute to its pharmacological properties, as this structure is often associated with various biological activities, including potential neuroactive effects. The tert-butyl ester functionality can enhance lipophilicity, influencing the compound's absorption and distribution in biological systems. Additionally, the compound may participate in hydrogen bonding and other intermolecular interactions due to the presence of functional groups, which can affect its reactivity and stability. Overall, tert-butyl 3-(1,3-benzodioxol-5-yl)piperazine-1-carboxylate is of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications.

Formula: C₁₆H₂₂N₂O₄

InChI: InChI=1/C16H22N2O4/c1-16(2,3)22-15(19)18-7-6-17-12(9-18)11-4-5-13-14(8-11)21-10-20-13/h4-5,8,12,17H,6-7,9-10H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1CCNC(C1)c1ccc2c(c1)OCO2

Synonyms:

• tert-Butyl 3-(1,3-benzodioxol-5-yl)piperazine-1-carboxylate