CymitQuimica logo

CAS 886771-26-2

:

tert-butyl 3-(2-furyl)piperazine-1-carboxylate

Description:
Tert-butyl 3-(2-furyl)piperazine-1-carboxylate is a chemical compound characterized by its unique structure, which includes a piperazine ring substituted with a furyl group and a tert-butyl ester. This compound typically exhibits properties associated with both the piperazine and furan moieties, such as potential biological activity and solubility in organic solvents. The presence of the tert-butyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. Additionally, the furan ring can contribute to the compound's reactivity and interaction with biological targets. The compound is often studied in medicinal chemistry for its potential applications in drug development, particularly in areas related to neuropharmacology and other therapeutic fields. Its synthesis and characterization involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C13H20N2O3
InChI:InChI=1/C13H20N2O3/c1-13(2,3)18-12(16)15-7-6-14-10(9-15)11-5-4-8-17-11/h4-5,8,10,14H,6-7,9H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCNC(C1)c1ccco1
Synonyms:
  • 2-Methyl-2-propanyl 3-(2-furyl)-1-piperazinecarboxylate
  • 2-Methyl-2-propanyl-3-(2-furyl)-1-piperazincarboxylat
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.