CAS 88678-17-5

sodium 2-acetyl-5-methoxyphenyl sulfate

Description:

Sodium 2-acetyl-5-methoxyphenyl sulfate, identified by its CAS number 88678-17-5, is a chemical compound that features a sulfate group attached to a phenolic structure. This compound is characterized by the presence of an acetyl group and a methoxy group on the aromatic ring, which contribute to its unique chemical properties. The sulfate moiety enhances its solubility in water, making it useful in various applications, including as a reagent in organic synthesis and potentially in pharmaceuticals. The methoxy group can influence the compound's reactivity and stability, while the acetyl group may affect its biological activity. As a sodium salt, it is typically more stable and easier to handle than its acid form. Overall, sodium 2-acetyl-5-methoxyphenyl sulfate is of interest in both industrial and research settings due to its functional groups and potential applications in chemical synthesis and biological studies.

Formula: C₉H₉NaO₆S

InChI: InChI=1/C9H10O6S.Na/c1-6(10)8-4-3-7(14-2)5-9(8)15-16(11,12)13;/h3-5H,1-2H3,(H,11,12,13);/q;+1/p-1

SMILES: CC(=O)c1ccc(cc1OS(=O)(=O)O)OC.[Na]

(2-Acetyl-5-methoxyphenyl) Sulfate Sodium Salt

Controlled Product

CAS: 88678-17-5

Formula: C₉H₉NaO₆S

Color and Shape: Neat

Molecular weight: 268.219

Ref: TR-A123770