CAS 88681-05-4

N-(3,5-Dichloro-4-nitrophenyl)benzenesulfonamide

Description:

N-(3,5-Dichloro-4-nitrophenyl)benzenesulfonamide, with the CAS number 88681-05-4, is a chemical compound characterized by its sulfonamide functional group attached to a phenyl ring, which is further substituted with a 3,5-dichloro-4-nitrophenyl moiety. This compound typically exhibits properties associated with sulfonamides, including potential antibacterial activity due to its ability to inhibit bacterial folic acid synthesis. The presence of chlorine and nitro groups in its structure may enhance its reactivity and influence its biological activity. It is generally a solid at room temperature and may be soluble in organic solvents, depending on the specific conditions. The compound's molecular structure suggests it could be used in various applications, including pharmaceuticals and agrochemicals. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity and environmental impact. Proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is crucial for confirming its identity and purity in research and industrial contexts.

Formula: C₁₂H₈Cl₂N₂O₄S

InChI: InChI=1S/C12H8Cl2N2O4S/c13-10-6-8(7-11(14)12(10)16(17)18)15-21(19,20)9-4-2-1-3-5-9/h1-7,15H

InChI key: InChIKey=TXNCGDZIICLOLC-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(Cl)C=C(NS(=O)(=O)C2=CC=CC=C2)C=C1Cl

Synonyms:

• N-(3,5-Dichloro-4-nitrophenyl)benzenesulfonamide
• Benzenesulfonamide, N-(3,5-dichloro-4-nitrophenyl)-

Benzenesulfonamide, N-(3,5-dichloro-4-nitrophenyl)-

CAS: 88681-05-4

Formula: C₁₂H₈Cl₂N₂O₄S

Molecular weight: 347.1739

Ref: IN-DA00479N