
CAS 88681-64-5
:(2Z)-2-(Acetylamino)-3-(2-methylphenyl)-2-propenoic acid
Description:
(2Z)-2-(Acetylamino)-3-(2-methylphenyl)-2-propenoic acid, also known by its CAS number 88681-64-5, is an organic compound characterized by its propenoic acid structure, which features an acetylamino group and a 2-methylphenyl substituent. This compound typically exhibits properties associated with both amino acids and aromatic compounds, including potential solubility in polar solvents due to the presence of the acetylamino group. Its propenoic acid moiety suggests that it may participate in various chemical reactions, such as polymerization or conjugation, making it of interest in synthetic organic chemistry. The presence of the aromatic ring can impart stability and influence the compound's reactivity, while the specific stereochemistry indicated by the (2Z) configuration suggests a particular geometric arrangement that may affect its biological activity and interactions. Overall, this compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific biological or industrial uses would depend on further research and characterization.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c1-8-5-3-4-6-10(8)7-11(12(15)16)13-9(2)14/h3-7H,1-2H3,(H,13,14)(H,15,16)/b11-7-
InChI key:InChIKey=CHZDNJUDKTYQAS-XFFZJAGNSA-N
SMILES:C(=C(\NC(C)=O)/C(O)=O)\C1=C(C)C=CC=C1
Synonyms:- (2Z)-2-(Acetylamino)-3-(2-methylphenyl)-2-propenoic acid
- 2-Propenoic acid, 2-(acetylamino)-3-(2-methylphenyl)-, (Z)-
- 2-Propenoic acid, 2-(acetylamino)-3-(2-methylphenyl)-, (2Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(2Z)-2-(Acetylamino)-3-(2-methylphenyl)-2-propenoic acid
CAS:Formula:C12H13NO3Color and Shape:SolidMolecular weight:219.2365
