CAS 88681-65-6

(2Z)-2-(Acetylamino)-3-(1-naphthalenyl)-2-propenoic acid

Description:

(2Z)-2-(Acetylamino)-3-(1-naphthalenyl)-2-propenoic acid, with the CAS number 88681-65-6, is an organic compound characterized by its unique structural features. It contains an acetylamino group and a naphthalenyl moiety, which contribute to its aromatic properties and potential biological activity. The compound features a propenoic acid backbone, indicating it has both unsaturation and acidic properties. This structure allows for various chemical reactivity, including potential participation in electrophilic addition reactions due to the presence of the double bond. The naphthalene ring enhances its hydrophobic characteristics, which may influence its solubility and interaction with biological systems. Additionally, the presence of the acetylamino group suggests potential for hydrogen bonding and interactions with other polar molecules. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug design. Its specific applications and behavior would depend on further studies and characterization in various chemical environments.

Formula: C₁₅H₁₃NO₃

InChI: InChI=1S/C15H13NO3/c1-10(17)16-14(15(18)19)9-12-7-4-6-11-5-2-3-8-13(11)12/h2-9H,1H3,(H,16,17)(H,18,19)/b14-9-

InChI key: InChIKey=ZGCQLATYQJVAAO-ZROIWOOFSA-N

SMILES: C(=C(\NC(C)=O)/C(O)=O)\C=1C2=C(C=CC1)C=CC=C2

Synonyms:

• 2-Propenoic acid, 2-(acetylamino)-3-(1-naphthalenyl)-, (Z)-
• (2Z)-2-(Acetylamino)-3-(1-naphthalenyl)-2-propenoic acid
• 2-Propenoic acid, 2-(acetylamino)-3-(1-naphthalenyl)-, (2Z)-

2-Propenoic acid, 2-(acetylamino)-3-(1-naphthalenyl)-, (Z)-

CAS: 88681-65-6

Formula: C₁₅H₁₃NO₃

Molecular weight: 255.2686

Ref: IN-DA0047GB