CymitQuimica logo

CAS 88683-57-2

:

3-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)sulfanyl]propanenitrile

Description:
3-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)sulfanyl]propanenitrile, with the CAS number 88683-57-2, is a chemical compound characterized by its unique structural features, including a propanenitrile group and a sulfanyl moiety linked to an isoindole derivative. This compound exhibits properties typical of nitriles, such as potential reactivity in nucleophilic addition reactions due to the presence of the cyano group. The isoindole structure contributes to its aromatic characteristics, which may influence its stability and reactivity. The presence of the dioxo functional groups suggests potential for hydrogen bonding and interactions with other molecules, which can affect solubility and biological activity. Additionally, the sulfanyl group may impart specific chemical reactivity, making it a candidate for various synthetic applications in organic chemistry. Overall, this compound's unique combination of functional groups positions it as an interesting subject for further research, particularly in the fields of medicinal chemistry and materials science.
Formula:C11H8N2O2S
InChI:InChI=1/C11H8N2O2S/c12-6-3-7-16-13-10(14)8-4-1-2-5-9(8)11(13)15/h1-2,4-5H,3,7H2
SMILES:c1ccc2c(c1)C(=O)N(C2=O)SCCC#N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.