
CAS 88684-13-3
:P-[2-(Trihydroxysilyl)ethyl]phosphonic acid
Description:
P-[2-(Trihydroxysilyl)ethyl]phosphonic acid, with the CAS number 88684-13-3, is a chemical compound characterized by its unique structure that combines both phosphonic acid and silanol functionalities. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its excellent adhesion properties, making it useful in various applications, including surface modification and as a coupling agent in composites. The presence of trihydroxysilyl groups allows for strong interactions with siliceous surfaces, enhancing bonding and stability. Additionally, the phosphonic acid group contributes to its potential as a chelating agent, which can interact with metal ions. This compound is often utilized in the formulation of coatings, adhesives, and sealants, where improved durability and performance are desired. Its compatibility with various substrates and ability to enhance surface properties make it a valuable additive in industrial applications. Safety data should be consulted for handling and usage guidelines, as with any chemical substance.
Formula:C2H9O6PSi
InChI:InChI=1S/C2H9O6PSi/c3-9(4,5)1-2-10(6,7)8/h6-8H,1-2H2,(H2,3,4,5)
InChI key:InChIKey=LXSIHXFNFUHKPO-UHFFFAOYSA-N
SMILES:C(C[Si](O)(O)O)P(=O)(O)O
Synonyms:- P-[2-(Trihydroxysilyl)ethyl]phosphonic acid
- Phosphonic acid, P-[2-(trihydroxysilyl)ethyl]-
- Phosphonic acid, [2-(trihydroxysilyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
