CymitQuimica logo

CAS 88684-29-1

:

Ethyl 5-[5-chloro-2-methoxy-4-[2-(5-nitro-2-thiazolyl)diazenyl]phenyl]-9-oxo-2,8,10-trioxa-5-azadodecanoate

Description:
Ethyl 5-[5-chloro-2-methoxy-4-[2-(5-nitro-2-thiazolyl)diazenyl]phenyl]-9-oxo-2,8,10-trioxa-5-azadodecanoate is a complex organic compound characterized by its multi-functional structure, which includes various chemical moieties such as a chloro group, methoxy group, and a nitro-substituted thiazole. The presence of the diazenyl group indicates potential for azo dye properties, which can impart color and reactivity. This compound features a dodecanoate backbone, suggesting it may exhibit amphiphilic characteristics, potentially allowing for solubility in both polar and non-polar solvents. The oxo and azole functionalities contribute to its reactivity and potential biological activity, making it of interest in medicinal chemistry and dye synthesis. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's CAS number, 88684-29-1, allows for easy identification in chemical databases, facilitating research and application in relevant fields such as pharmaceuticals and materials science.
Formula:C20H24ClN5O9S
InChI:InChI=1S/C20H24ClN5O9S/c1-4-32-19(27)34-8-6-25(7-9-35-20(28)33-5-2)15-10-13(21)14(11-16(15)31-3)23-24-18-22-12-17(36-18)26(29)30/h10-12H,4-9H2,1-3H3
InChI key:InChIKey=RLFNPKRRWQLBBK-UHFFFAOYSA-N
SMILES:N(CCOC(OCC)=O)(CCOC(OCC)=O)C1=C(OC)C=C(N=NC=2SC(N(=O)=O)=CN2)C(Cl)=C1
Synonyms:
  • 2,8,10-Trioxa-5-azadodecanoic acid, 5-[5-chloro-2-methoxy-4-[(5-nitro-2-thiazolyl)azo]phenyl]-9-oxo-, ethyl ester
  • 2,8,10-Trioxa-5-azadodecanoic acid, 5-[5-chloro-2-methoxy-4-[2-(5-nitro-2-thiazolyl)diazenyl]phenyl]-9-oxo-, ethyl ester
  • Ethyl 5-[5-chloro-2-methoxy-4-[2-(5-nitro-2-thiazolyl)diazenyl]phenyl]-9-oxo-2,8,10-trioxa-5-azadodecanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.