CAS 886851-25-8

N-methyl-1-(5-methyl-1,2-oxazol-3-yl)methanamine

Description:

N-methyl-1-(5-methyl-1,2-oxazol-3-yl)methanamine is a chemical compound characterized by its unique structure, which includes a methyl group attached to a methanamine moiety and an oxazole ring. The oxazole ring contributes to its heterocyclic nature, providing specific reactivity and potential biological activity. This compound is likely to exhibit polar characteristics due to the presence of the amine functional group, which can engage in hydrogen bonding. The methyl substitution on the oxazole ring may influence its lipophilicity and solubility in organic solvents. Additionally, the presence of nitrogen in both the oxazole and amine groups suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may also impart specific electronic properties, affecting its reactivity and stability under various conditions. Overall, N-methyl-1-(5-methyl-1,2-oxazol-3-yl)methanamine is a compound with potential applications in pharmaceuticals and research, warranting further investigation into its properties and effects.

Formula: C₆H₁₀N₂O

InChI: InChI=1/C6H10N2O/c1-5-3-6(4-7-2)8-9-5/h3,7H,4H2,1-2H3

SMILES: Cc1cc(CNC)no1

Synonyms:

• 3-isoxazolemethanamine, N,5-dimethyl-
• N,5-Dimethylisoxazol-3-Ylmethylamine

N-Methyl-1-(5-methylisoxazol-3-yl)methanamine

CAS: 886851-25-8

Formula: C₆H₁₀N₂O

Molecular weight: 126.1564

Ref: IN-DA00478X

N,5-Dimethylisoxazol-3-ylmethylamine

CAS: 886851-25-8

Versatile small molecule scaffold

Formula: C₆H₁₀N₂O

Purity: Min. 95%

Molecular weight: 126.16 g/mol

Ref: 3D-LKB85125