CymitQuimica logo

CAS 886851-30-5

:

N-methyl-1-(6-morpholin-4-ylpyridin-2-yl)methanamine

Description:
N-methyl-1-(6-morpholin-4-ylpyridin-2-yl)methanamine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a morpholine group and a methylated amine. This compound typically exhibits properties associated with both amines and heterocyclic compounds, such as basicity and potential for hydrogen bonding due to the presence of nitrogen atoms. Its molecular structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit biological activity. The morpholine moiety can enhance solubility and bioavailability, while the pyridine ring may contribute to interactions with biological targets. Additionally, the presence of the N-methyl group can influence the compound's lipophilicity and pharmacokinetic properties. Overall, N-methyl-1-(6-morpholin-4-ylpyridin-2-yl)methanamine is a compound of interest in research and development, particularly in the fields of drug discovery and organic synthesis.
Formula:C11H17N3O
InChI:InChI=1/C11H17N3O/c1-12-9-10-3-2-4-11(13-10)14-5-7-15-8-6-14/h2-4,12H,5-9H2,1H3
SMILES:CNCc1cccc(n1)N1CCOCC1
Synonyms:
  • N-methyl-N-[(6-morpholin-4-ylpyridin-2-yl)methyl]amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.