CAS 886851-30-5

N-methyl-1-(6-morpholin-4-ylpyridin-2-yl)methanamine

Description:

N-methyl-1-(6-morpholin-4-ylpyridin-2-yl)methanamine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a morpholine group and a methylated amine. This compound typically exhibits properties associated with both amines and heterocyclic compounds, such as basicity and potential for hydrogen bonding due to the presence of nitrogen atoms. Its molecular structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit biological activity. The morpholine moiety can enhance solubility and bioavailability, while the pyridine ring may contribute to interactions with biological targets. Additionally, the presence of the N-methyl group can influence the compound's lipophilicity and pharmacokinetic properties. Overall, N-methyl-1-(6-morpholin-4-ylpyridin-2-yl)methanamine is a compound of interest in research and development, particularly in the fields of drug discovery and organic synthesis.

Formula: C₁₁H₁₇N₃O

InChI: InChI=1/C11H17N3O/c1-12-9-10-3-2-4-11(13-10)14-5-7-15-8-6-14/h2-4,12H,5-9H2,1H3

SMILES: CNCc1cccc(n1)N1CCOCC1

Synonyms:

• N-methyl-N-[(6-morpholin-4-ylpyridin-2-yl)methyl]amine

methyl({[6-(morpholin-4-yl)pyridin-2-yl]methyl})amine

CAS: 886851-30-5

Formula: C₁₁H₁₇N₃O

Molecular weight: 207.2722

Ref: IN-DA0047UP