CymitQuimica logo

CAS 886851-33-8

:

3-(2-Furanyl)-1-methyl-1H-pyrazole-5-methanol

Description:
3-(2-Furanyl)-1-methyl-1H-pyrazole-5-methanol is an organic compound characterized by its unique structure, which includes a pyrazole ring substituted with a furan group and a hydroxymethyl group. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential reactivity due to the presence of the hydroxymethyl group, which can participate in various chemical reactions. The furan moiety contributes to its aromatic character and may influence its solubility and stability. The compound may also display biological activity, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be influenced by the presence of functional groups, which can affect its polarity and ability to form hydrogen bonds. Overall, 3-(2-Furanyl)-1-methyl-1H-pyrazole-5-methanol is a compound of interest for further research, particularly in the fields of organic synthesis and pharmacology.
Formula:C9H10N2O2
InChI:InChI=1/C9H10N2O2/c1-11-7(6-12)5-8(10-11)9-3-2-4-13-9/h2-5,12H,6H2,1H3
InChI key:InChIKey=BYXYWFXMSJTOKB-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=NN1C)C2=CC=CO2
Synonyms:
  • 1H-Pyrazole-5-methanol, 3-(2-furanyl)-1-methyl-
  • 3-(2-Furanyl)-1-methyl-1H-pyrazole-5-methanol
  • [3-(2-furyl)-1-methyl-1H-pyrazol-5-yl]methanol
  • [3-(Furan-2-yl)-1-methyl-1H-pyrazol-5-yl]methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.