CymitQuimica logo

CAS 886851-44-1

:

6-(2-Furanyl)-N-methyl-3-pyridinemethanamine

Description:
6-(2-Furanyl)-N-methyl-3-pyridinemethanamine, with the CAS number 886851-44-1, is an organic compound characterized by its unique structural features, which include a pyridine ring and a furan moiety. This compound typically exhibits properties associated with both aromatic systems, such as stability and potential for various chemical interactions. The presence of the furan ring contributes to its reactivity, particularly in electrophilic substitution reactions. The N-methyl group enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. Additionally, the compound may exhibit basic properties due to the nitrogen atom in the pyridine ring, allowing it to participate in protonation reactions. Its specific applications and biological activities would depend on further studies, but compounds with similar structures are often explored for their potential in pharmaceuticals and agrochemicals. Overall, 6-(2-Furanyl)-N-methyl-3-pyridinemethanamine represents a class of compounds with diverse chemical behavior and potential utility in various fields.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-12-7-9-4-5-10(13-8-9)11-3-2-6-14-11/h2-6,8,12H,7H2,1H3
InChI key:InChIKey=UDZJNNURWGNFCN-UHFFFAOYSA-N
SMILES:C(NC)C1=CC=C(N=C1)C2=CC=CO2
Synonyms:
  • 6-(2-Furanyl)-N-methyl-3-pyridinemethanamine
  • N-Methyl-[6-(2-Furyl)Pyrid-3-Yl]Methylamine
  • [[6-(Furan-2-yl)pyridin-3-yl]methyl](methyl)amine
  • 3-Pyridinemethanamine, 6-(2-furanyl)-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.