CAS 886851-53-2
:7-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonyl chloride
Description:
7-Bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonyl chloride is a heterocyclic organic compound characterized by its unique structural features, including a thieno-dioxine ring system and a carbonyl chloride functional group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations. This compound typically exhibits moderate to high stability under standard conditions but may be sensitive to moisture and light due to the presence of the carbonyl chloride group, which can hydrolyze to form the corresponding acid. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in materials science. The compound's reactivity profile allows for further derivatization, which can enhance its biological activity or alter its physical properties. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance, as it may pose health risks. Overall, 7-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonyl chloride is a versatile compound with significant potential in various chemical applications.
Formula:C7H4BrClO3S
InChI:InChI=1/C7H4BrClO3S/c8-6-4-3(11-1-2-12-4)5(13-6)7(9)10/h1-2H2
SMILES:C1COc2c(c(C(=O)Cl)sc2Br)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
7-bromo-2H,3H-thieno[3,4-b][1,4]dioxine-5-carbonyl chloride
CAS:Formula:C7H4BrClO3SMolecular weight:283.52697-Bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonyl chloride
CAS:<p>7-Bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonyl chloride</p>Formula:C7H4BrClO3SPurity:techColor and Shape: very dark blue powderMolecular weight:283.53g/mol

