CymitQuimica logo

CAS 886851-58-7

:

1-(6-Methyl-2-pyrazinyl)-4-piperidinecarboxylic acid

Description:
1-(6-Methyl-2-pyrazinyl)-4-piperidinecarboxylic acid, identified by its CAS number 886851-58-7, is a chemical compound characterized by its unique structural features, which include a piperidine ring and a pyrazine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The methyl group on the pyrazine ring may influence its lipophilicity and biological activity. As a piperidine derivative, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The presence of both the pyrazine and piperidine structures suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's stability, reactivity, and potential applications in various fields, including pharmaceuticals and agrochemicals, are areas of ongoing research. Overall, this compound represents a fascinating example of how structural variations can lead to diverse chemical behaviors and applications.
Formula:C11H15N3O2
InChI:InChI=1S/C11H15N3O2/c1-8-6-12-7-10(13-8)14-4-2-9(3-5-14)11(15)16/h6-7,9H,2-5H2,1H3,(H,15,16)
InChI key:InChIKey=MBDLISJDSPPRMR-UHFFFAOYSA-N
SMILES:CC=1N=C(N2CCC(C(O)=O)CC2)C=NC1
Synonyms:
  • 1-(6-Methyl-2-pyrazinyl)-4-piperidinecarboxylic acid
  • 4-Piperidinecarboxylic acid, 1-(6-methylpyrazinyl)-
  • 4-Piperidinecarboxylic acid, 1-(6-methyl-2-pyrazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.