CAS 886851-59-8

[1-(6-methylpyrazin-2-yl)piperidin-4-yl]methanol

Description:

[1-(6-methylpyrazin-2-yl)piperidin-4-yl]methanol, with the CAS number 886851-59-8, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with a 6-methylpyrazine moiety. The presence of the pyrazine ring introduces aromatic characteristics and potential for various interactions, such as hydrogen bonding and pi-stacking. The methanol group (-CH2OH) attached to the piperidine enhances its solubility in polar solvents and may contribute to its reactivity. This compound may exhibit biological activity due to its structural motifs, making it of interest in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and the overall molecular structure. As with many organic compounds, it is essential to handle it with care, considering safety data and potential hazards associated with its use.

Formula: C₁₁H₁₇N₃O

InChI: InChI=1/C11H17N3O/c1-9-6-12-7-11(13-9)14-4-2-10(8-15)3-5-14/h6-7,10,15H,2-5,8H2,1H3

SMILES: Cc1cncc(n1)N1CCC(CC1)CO

Synonyms:

• [1-(6-Methylpyrazin-2-Yl)Piperid-4-Yl]Methanol