CymitQuimica logo

CAS 886851-60-1

:

ethyl 1-(6-methylpyrazin-2-yl)piperidine-4-carboxylate

Description:
Ethyl 1-(6-methylpyrazin-2-yl)piperidine-4-carboxylate is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with a 6-methylpyrazin-2-yl group and an ethyl ester functional group. This compound typically exhibits properties associated with both piperidine and pyrazine derivatives, such as moderate polarity and potential for hydrogen bonding due to the presence of the carboxylate group. It may display biological activity, making it of interest in medicinal chemistry and drug development. The presence of the pyrazine moiety can contribute to its aromatic character, influencing its solubility and reactivity. Additionally, the ethyl ester group can affect its pharmacokinetic properties, such as absorption and metabolism. Overall, this compound's characteristics make it a valuable subject for further research, particularly in the fields of organic synthesis and pharmaceutical applications.
Formula:C13H19N3O2
InChI:InChI=1/C13H19N3O2/c1-3-18-13(17)11-4-6-16(7-5-11)12-9-14-8-10(2)15-12/h8-9,11H,3-7H2,1-2H3
SMILES:CCOC(=O)C1CCN(CC1)c1cncc(C)n1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.