CAS 886859-72-9

6-Iodoimidazo[1,2-a]pyridine-3-carbonitrile

Description:

6-Iodoimidazo[1,2-a]pyridine-3-carbonitrile is a heterocyclic compound characterized by the presence of an imidazole ring fused to a pyridine ring, along with a cyano group and an iodine substituent. This compound features a unique structural arrangement that contributes to its potential biological activity and chemical reactivity. The iodine atom introduces a halogen, which can enhance the compound's lipophilicity and influence its interaction with biological targets. The cyano group (-C≡N) is known for its electron-withdrawing properties, which can affect the compound's reactivity and stability. This substance may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it may be utilized in various applications, including drug development and material science. As with many heterocycles, the electronic properties and steric factors of 6-Iodoimidazo[1,2-a]pyridine-3-carbonitrile play a crucial role in determining its behavior in chemical reactions and interactions with biological systems.

Formula: C₈H₄IN₃

InChI: InChI=1S/C8H4IN3/c9-6-1-2-8-11-4-7(3-10)12(8)5-6/h1-2,4-5H

InChI key: InChIKey=WEHFFOUQVOGCMZ-UHFFFAOYSA-N

SMILES: C(#N)C=1N2C(=NC1)C=CC(I)=C2

Synonyms:

• 6-Iodoimidazo[1,2-a]pyridine-3-carbonitrile
• Imidazo[1,2-a]pyridine-3-carbonitrile, 6-iodo-