CAS 886967-70-0

4,5-Dihydro-3-[4-(1-methylethyl)phenyl]-5-isoxazolecarboxylic acid

Description:

4,5-Dihydro-3-[4-(1-methylethyl)phenyl]-5-isoxazolecarboxylic acid, with the CAS number 886967-70-0, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a carboxylic acid functional group, contributing to its acidic properties. The presence of the isopropyl-substituted phenyl group enhances its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. The dihydro configuration indicates that the compound may exhibit specific stereochemical properties, which can affect its biological activity and reactivity. Such compounds are often studied for their potential pharmaceutical applications, particularly in the fields of anti-inflammatory or analgesic agents. The stability, reactivity, and biological activity of this compound can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, this compound represents a unique structure that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₃H₁₅NO₃

InChI: InChI=1S/C13H15NO3/c1-8(2)9-3-5-10(6-4-9)11-7-12(13(15)16)17-14-11/h3-6,8,12H,7H2,1-2H3,(H,15,16)

InChI key: InChIKey=ZJWKFUQHRGKTOA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC(=NO1)C2=CC=C(C(C)C)C=C2

Synonyms:

• 5-Isoxazolecarboxylic acid, 4,5-dihydro-3-[4-(1-methylethyl)phenyl]-
• 4,5-Dihydro-3-[4-(1-methylethyl)phenyl]-5-isoxazolecarboxylic acid

3-[4-(propan-2-yl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxylic acid

CAS: 886967-70-0

Formula: C₁₃H₁₅NO₃

Purity: 95.0%

Molecular weight: 233.267

Ref: 10-F526042