CAS 887-15-0
:Tetrahydro-2,2-diphenylfuran
Description:
Tetrahydro-2,2-diphenylfuran, with the CAS number 887-15-0, is an organic compound characterized by its unique structure, which includes a furan ring that is fully saturated with two phenyl groups attached to the 2-position. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its aromatic properties and is often used in organic synthesis and as an intermediate in the production of various chemical compounds. The presence of the furan ring contributes to its reactivity, allowing it to participate in various chemical reactions, including electrophilic substitutions and cycloadditions. Tetrahydro-2,2-diphenylfuran is relatively stable under standard conditions but may undergo degradation when exposed to strong oxidizing agents or extreme temperatures. Its solubility in organic solvents makes it useful in various applications, including pharmaceuticals and materials science. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C16H16O
InChI:InChI=1S/C16H16O/c1-3-8-14(9-4-1)16(12-7-13-17-16)15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2
InChI key:InChIKey=ONRSPOWNRLCCGF-UHFFFAOYSA-N
SMILES:C1(CCCO1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 2,2-Diphenyltetrahydrofuran
- Furan, tetrahydro-2,2-diphenyl-
- NSC 89761
- Tetrahydro-2,2-diphenylfuran
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
