CAS 887-77-4

2-Naphthalenediazonium, 1-hydroxy-4-sulfo-, inner salt

Description:

2-Naphthalenediazonium, 1-hydroxy-4-sulfo-, inner salt, with CAS number 887-77-4, is a chemical compound characterized by its diazonium structure, which is a key feature in many organic reactions, particularly in azo coupling processes. This compound contains a naphthalene ring system, which contributes to its aromatic properties and stability. The presence of a hydroxyl group and a sulfonic acid group indicates its potential for solubility in water and reactivity in various chemical transformations. As an inner salt, it exhibits unique properties that can influence its behavior in solution, such as pH sensitivity and ionic interactions. This compound is often utilized in dye chemistry and can serve as an intermediate in the synthesis of various azo dyes, which are widely used in textiles and other industries. Its reactivity is primarily due to the diazonium group, making it a valuable reagent in organic synthesis. Safety precautions should be taken when handling this compound, as diazonium salts can be sensitive to heat and light, potentially leading to decomposition.

Formula: C₁₀H₆N₂O₄S

InChI: InChI=1/C10H6N2O4S/c11-12-8-5-9(17(14,15)16)6-3-1-2-4-7(6)10(8)13/h1-5H,(H-,13,14,15,16)

InChI key: InChIKey=TUXAJHDLJHMOQB-UHFFFAOYSA-N

SMILES: S(=O)(=O)([O-])C=1C2=C(C(O)=C([N+]#N)C1)C=CC=C2

Synonyms:

• 4-Sulfo-2,1-diazonaphthol
• 1-Hydroxy-4-sulphonatonaphthalene-2-diazonium
• 1-Hydroxy-4-sulfo-2-naphthalenediazonium hydroxide, inner salt
• 3-Diazonio-4-hydroxynaphthalene-1-sulfonate
• 2-Naphthalenediazonium, 1-hydroxy-4-sulfo-, inner salt
• 2-Naphthalenediazonium, 1-hydroxy-4-sulfo-, hydroxide, inner salt

2-Naphthalenediazonium,1-hydroxy-4-sulfo-, inner salt

CAS: 887-77-4

Formula: C₁₀H₆N₂O₄S

Molecular weight: 250.2306

Ref: IN-DA004CZJ