CAS 88701-15-9

trans-4-(4-Pentylcyclohexyl)-4'-propyl-1,1'-biphenyl

Description:

Trans-4-(4-Pentylcyclohexyl)-4'-propyl-1,1'-biphenyl, with the CAS number 88701-15-9, is a chemical compound that belongs to the class of liquid crystals, specifically a type of biphenyl derivative. This substance exhibits characteristics typical of liquid crystalline materials, including the ability to flow like a liquid while maintaining some degree of ordered structure, which is crucial for applications in display technologies. Its molecular structure features a biphenyl core with substituents that enhance its thermal stability and mesogenic properties, making it suitable for use in liquid crystal displays (LCDs). The presence of the pentylcyclohexyl and propyl groups contributes to its unique phase behavior, influencing its melting and clearing points, as well as its optical properties. Additionally, this compound is likely to exhibit anisotropic behavior, meaning its physical properties vary depending on the direction of measurement, a key feature for liquid crystal applications. Overall, trans-4-(4-Pentylcyclohexyl)-4'-propyl-1,1'-biphenyl is significant in the field of materials science and liquid crystal technology.

Formula: C₂₆H₃₆

InChI: InChI=1/C26H36/c1-3-5-6-8-22-11-15-24(16-12-22)26-19-17-25(18-20-26)23-13-9-21(7-4-2)10-14-23/h9-10,13-14,17-20,22,24H,3-8,11-12,15-16H2,1-2H3/t22-,24-

SMILES: CCCCC[C@H]1CC[C@@H](CC1)c1ccc(cc1)c1ccc(CCC)cc1

Synonyms:

• 4-trans-n-Pentylcyclohexyl-4'-propylbiphenyl
• 4-trans-pentylcyclohexyl-4'-propylbiphenyl
• trans-4-(4-Pentylcyclohexyl)-4'-propyl-1,1'-biphenyl