CymitQuimica logo

CAS 88702-70-9

:

2-Octadecyl-1,4-cyclohexanedione

Description:
2-Octadecyl-1,4-cyclohexanedione, with the CAS number 88702-70-9, is an organic compound characterized by its long hydrophobic alkyl chain and a cyclic diketone structure. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its amphiphilic nature due to the presence of both hydrophobic and polar functional groups. The presence of the cyclohexanedione moiety contributes to its potential reactivity, allowing it to participate in various chemical reactions, such as condensation or complexation with metal ions. Its long alkyl chain enhances its surface-active properties, making it useful in applications such as surfactants, emulsifiers, or additives in polymer formulations. Additionally, the compound may exhibit interesting thermal and mechanical properties, which can be advantageous in materials science. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.
Formula:C24H44O2
InChI:InChI=1S/C24H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-21-23(25)19-20-24(22)26/h22H,2-21H2,1H3
InChI key:InChIKey=FRQKJTUDIWUEIB-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCC)C1C(=O)CCC(=O)C1
Synonyms:
  • 2-Octadecyl-1,4-cyclohexanedione
  • 1,4-Cyclohexanedione, 2-octadecyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.