CAS 887029-38-1
:2-(1-Piperazinylmethyl)cyclohexanemethanol
Description:
2-(1-Piperazinylmethyl)cyclohexanemethanol, identified by its CAS number 887029-38-1, is a chemical compound characterized by its unique structure that includes a cyclohexane ring, a piperazine moiety, and a hydroxymethyl group. This compound typically exhibits properties associated with both cyclic and aliphatic amines, which may influence its solubility and reactivity. The presence of the piperazine ring suggests potential for interactions with biological systems, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The hydroxymethyl group can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the compound may exhibit basic properties due to the nitrogen atoms in the piperazine ring, which can accept protons. Overall, 2-(1-Piperazinylmethyl)cyclohexanemethanol is notable for its structural features that may confer specific pharmacological activities, although detailed studies would be necessary to fully elucidate its biological effects and potential applications.
Formula:C12H24N2O
InChI:InChI=1S/C12H24N2O/c15-10-12-4-2-1-3-11(12)9-14-7-5-13-6-8-14/h11-13,15H,1-10H2
InChI key:InChIKey=YYEKXUHZBSLXAK-UHFFFAOYSA-N
SMILES:C(C1C(CO)CCCC1)N2CCNCC2
Synonyms:- Cyclohexanemethanol, 2-(1-piperazinylmethyl)-
- 2-(1-Piperazinylmethyl)cyclohexanemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.