CAS 887031-20-1
:4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-methyl-2-thiazolamine
Description:
4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-methyl-2-thiazolamine, identified by its CAS number 887031-20-1, is a chemical compound that features a thiazole ring, which is known for its diverse biological activities. The presence of the benzodioxin moiety suggests potential applications in medicinal chemistry, particularly due to its structural similarity to various bioactive compounds. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would be necessary to confirm these effects. Its molecular structure includes both aromatic and heterocyclic components, contributing to its chemical reactivity and potential interactions with biological targets. Additionally, the thiazole group can participate in various chemical reactions, making it a versatile building block in organic synthesis. As with many compounds, the solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Further research would be essential to fully elucidate its properties and potential applications in pharmaceuticals or other fields.
Formula:C12H12N2O2S
InChI:InChI=1S/C12H12N2O2S/c1-7-11(14-12(13)17-7)8-2-3-9-10(6-8)16-5-4-15-9/h2-3,6H,4-5H2,1H3,(H2,13,14)
InChI key:InChIKey=GZUXSYWANTVMEE-UHFFFAOYSA-N
SMILES:CC1=C(N=C(N)S1)C=2C=C3C(=CC2)OCCO3
Synonyms:- 2-Thiazolamine, 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methyl-
- 4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-methyl-2-thiazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.