CAS 887031-24-5

2-Amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-thiazoleacetic acid

Description:

2-Amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-thiazoleacetic acid, with the CAS number 887031-24-5, is a chemical compound characterized by its complex structure, which includes a thiazole ring and a benzodioxin moiety. This compound typically exhibits properties associated with both amino acids and heterocyclic compounds, making it of interest in various fields, including medicinal chemistry and pharmacology. The presence of the thiazole group suggests potential biological activity, as thiazoles are often found in biologically active molecules. Additionally, the benzodioxin component may contribute to its stability and solubility in organic solvents. The compound's functional groups, particularly the amino and carboxylic acid groups, can participate in hydrogen bonding and ionic interactions, influencing its reactivity and interaction with biological targets. Overall, this compound's unique structural features may provide avenues for research into its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation.

Formula: C₁₃H₁₂N₂O₄S

InChI: InChI=1S/C13H12N2O4S/c14-13-15-12(10(20-13)6-11(16)17)7-1-2-8-9(5-7)19-4-3-18-8/h1-2,5H,3-4,6H2,(H2,14,15)(H,16,17)

InChI key: InChIKey=UFTYXDMSCKQDED-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C(N=C(N)S1)C=2C=C3C(=CC2)OCCO3

Synonyms:

• 2-Amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-thiazoleacetic acid
• 5-Thiazoleacetic acid, 2-amino-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-