CymitQuimica logo

CAS 887041-78-3

:

4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(4-methoxyphenyl)-2-pyrrolidinone

Description:
4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(4-methoxyphenyl)-2-pyrrolidinone is a chemical compound characterized by its complex structure, which includes a pyrrolidinone ring, a thiadiazole moiety, and a methoxyphenyl group. The presence of the amino group on the thiadiazole contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound's molecular framework suggests it may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. The CAS number 887041-78-3 uniquely identifies this compound, facilitating its recognition in scientific literature and databases. Overall, this substance represents a class of heterocyclic compounds that may have applications in drug development and other fields of chemistry.
Formula:C13H14N4O2S
InChI:InChI=1S/C13H14N4O2S/c1-19-10-4-2-9(3-5-10)17-7-8(6-11(17)18)12-15-16-13(14)20-12/h2-5,8H,6-7H2,1H3,(H2,14,16)
InChI key:InChIKey=JNDCHLDGKPOSPN-UHFFFAOYSA-N
SMILES:O=C1N(CC(C1)C=2SC(N)=NN2)C3=CC=C(OC)C=C3
Synonyms:
  • 2-Pyrrolidinone, 4-(5-amino-1,3,4-thiadiazol-2-yl)-1-(4-methoxyphenyl)-
  • 4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(4-methoxyphenyl)-2-pyrrolidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.