CymitQuimica logo

CAS 88708-44-5

:

Piperazine, 1-[2-(phenylthio)ethyl]-, (2Z)-2-butenedioate (1:2)

Description:
Piperazine, 1-[2-(phenylthio)ethyl]-, (2Z)-2-butenedioate (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a phenylthioethyl substituent, indicating the presence of a phenyl group attached to a sulfur atom, which is further connected to an ethyl chain. The (2Z)-2-butenedioate component suggests that it contains a butenedioate moiety with a specific geometric configuration, denoting the arrangement of substituents around the double bond. This compound may exhibit properties typical of piperazine derivatives, such as potential biological activity, including antimicrobial or antitumor effects, due to the presence of the phenylthio group. Its solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure. As with many piperazine derivatives, it may also serve as a scaffold for drug development, particularly in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H18N2S·2C4H4O4
InChI:InChI=1S/C12H18N2S.C4H4O4/c1-2-4-12(5-3-1)15-11-10-14-8-6-13-7-9-14;5-3(6)1-2-4(7)8/h1-5,13H,6-11H2;1-2H,(H,5,6)(H,7,8)/b;2-1-
InChI key:InChIKey=AOLLANZWKMPOBF-BTJKTKAUSA-N
SMILES:S(CCN1CCNCC1)C2=CC=CC=C2.C(=C\C(O)=O)\C(O)=O
Synonyms:
  • Piperazine, 1-[2-(phenylthio)ethyl]-, (2Z)-2-butenedioate (1:2)
  • Piperazine, 1-[2-(phenylthio)ethyl]-, (Z)-2-butenedioate (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.