CAS 88708-70-7

2,2,2-Trifluoro-N-(phenylmethyl)ethanimidoyl chloride

Description:

2,2,2-Trifluoro-N-(phenylmethyl)ethanimidoyl chloride, with the CAS number 88708-70-7, is a chemical compound characterized by its unique structure that includes a trifluoroethyl group and an imidoyl chloride functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the presence of the imidoyl chloride moiety, which can participate in various nucleophilic substitution reactions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in pharmaceutical chemistry. Additionally, the presence of the phenylmethyl group contributes to its stability and solubility in organic solvents. Safety precautions are necessary when handling this compound, as it may be corrosive and toxic. Overall, 2,2,2-Trifluoro-N-(phenylmethyl)ethanimidoyl chloride is a valuable intermediate in organic synthesis, particularly in the development of fluorinated compounds.

Formula: C₉H₇ClF₃N

InChI: InChI=1S/C9H7ClF3N/c10-8(9(11,12)13)14-6-7-4-2-1-3-5-7/h1-5H,6H2

InChI key: InChIKey=ZSRKHHOFCRGTQX-UHFFFAOYSA-N

SMILES: C(N=C(C(F)(F)F)Cl)C1=CC=CC=C1

Synonyms:

• N-Benzyltrifluoroacetimidoyl chloride
• Ethanimidoyl chloride, 2,2,2-trifluoro-N-(phenylmethyl)-
• 2,2,2-Trifluoro-N-(phenylmethyl)ethanimidoyl chloride

Ethanimidoyl chloride, 2,2,2-trifluoro-N-(phenylmethyl)-

CAS: 88708-70-7

Formula: C₉H₇ClF₃N

Molecular weight: 221.6068

Ref: IN-DA0046G8