CymitQuimica logo

CAS 887115-54-0

:

5-Bromo-1-phenyl-1H-pyrazolo[3,4-b]pyridine

Description:
5-Bromo-1-phenyl-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its unique pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a bromine substituent at the 5-position of the pyrazole ring and a phenyl group at the 1-position, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the bromine atom can enhance its reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. Compounds of this type are often investigated for their pharmacological properties, including potential anti-inflammatory, anti-cancer, or neuroprotective effects. The specific interactions and mechanisms of action would depend on the compound's structure and the biological targets involved. As with many heterocycles, the electronic properties and steric factors play a crucial role in determining its reactivity and interactions with other molecules.
Formula:C12H8BrN3
InChI:InChI=1S/C12H8BrN3/c13-10-6-9-7-15-16(12(9)14-8-10)11-4-2-1-3-5-11/h1-8H
InChI key:InChIKey=MOKRFXBAZIHBST-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(N(N=C2)C3=CC=CC=C3)=NC1
Synonyms:
  • 1H-Pyrazolo[3,4-b]pyridine, 5-bromo-1-phenyl-
  • 5-Bromo-1-phenyl-1H-pyrazolo[3,4-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.