CAS 887118-43-6

2,7-Diazaspiro[4.5]decan-1-one

Description:

2,7-Diazaspiro[4.5]decan-1-one is a bicyclic compound characterized by its unique spiro structure, which consists of two rings sharing a single atom. This compound features two nitrogen atoms incorporated into its framework, contributing to its diaza classification. The presence of a carbonyl group (C=O) at the 1-position of the spiro system is significant, as it influences the compound's reactivity and potential applications in organic synthesis and medicinal chemistry. The spiro configuration often imparts distinctive steric and electronic properties, making such compounds of interest in drug design and development. Additionally, the nitrogen atoms can participate in hydrogen bonding and coordination with metal ions, enhancing the compound's versatility in various chemical environments. Overall, 2,7-Diazaspiro[4.5]decan-1-one exemplifies a class of compounds that can exhibit interesting biological activities and serve as valuable intermediates in synthetic chemistry.

Formula: C₈H₁₅ClNO₂

InChI: InChI=1/C13H22N2O3/c1-12(2,3)18-11(17)15-8-4-5-13(9-15)6-7-14-10(13)16/h4-9H2,1-3H3,(H,14,16)

SMILES: CC(C)(C)OC(=O)N1CCCC2(CCN=C2O)C1

2,7-Diazaspiro[4.5]decan-1-one

CAS: 887118-43-6

Formula: C₈H₁₄N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 154.2096

Ref: IN-DA0045DJ

2,7-Diazaspiro[4.5]decan-1-one

CAS: 887118-43-6

Formula: C₈H₁₄N₂O

Purity: ≥95%

Molecular weight: 154.213

Ref: 10-F078160