CAS 887140-03-6
:benzene, 2-bromo-1-(chloromethyl)-4-fluoro-
Description:
Benzene, 2-bromo-1-(chloromethyl)-4-fluoro- is an organic compound characterized by its aromatic benzene ring substituted with a bromine atom at the second position, a chloromethyl group at the first position, and a fluorine atom at the fourth position. This compound belongs to the class of halogenated aromatic hydrocarbons, which are known for their diverse applications in chemical synthesis and as intermediates in the production of various pharmaceuticals and agrochemicals. The presence of multiple halogen substituents can significantly influence the compound's reactivity, polarity, and overall chemical behavior. Additionally, the specific arrangement of these substituents can affect the compound's physical properties, such as boiling and melting points, as well as its solubility in different solvents. Due to the presence of halogens, this compound may exhibit unique characteristics, including potential biological activity and environmental persistence. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks and environmental concerns.
Formula:C7H5BrClF
InChI:InChI=1/C7H5BrClF/c8-7-3-6(10)2-1-5(7)4-9/h1-3H,4H2
SMILES:c1cc(cc(c1CCl)Br)F
Synonyms:- 2-Bromo-1-(chloromethyl)-4-fluorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.