CAS 887144-97-0
:3,3-Dimethyl-1-(trifluoromethyl)-1,2-benziodoxole
Description:
3,3-Dimethyl-1-(trifluoromethyl)-1,2-benziodoxole is an organofluorine compound characterized by its unique structure that includes a benziodoxole core, which is a five-membered ring containing iodine. This compound features a trifluoromethyl group, which significantly enhances its reactivity and lipophilicity, making it useful in various chemical applications, particularly in organic synthesis and as a reagent in fluorination reactions. The presence of the dimethyl groups contributes to its steric bulk, influencing its reactivity and interaction with other molecules. Typically, compounds of this nature exhibit stability under standard conditions but may decompose or react under specific circumstances, such as exposure to moisture or heat. Its applications often extend to the fields of medicinal chemistry and materials science, where it can serve as a building block for more complex fluorinated compounds. Safety considerations should be taken into account due to the presence of iodine and fluorine, which can pose health risks if not handled properly.
Formula:C10H10F3IO
InChI:InChI=1/C10H10F3IO/c1-9(2)7-5-3-4-6-8(7)14(15-9)10(11,12)13/h3-6H,1-2H3
SMILES:CC1(C)c2ccccc2I(C(F)(F)F)O1
Synonyms:- Togni's Reagent
- 3,3-Dimethyl-1-(Trifluoromethyl)-1,3-Dihydro-1Λ3,2-Benziodoxole
- 1,3-Dihydro-3,3-dimethyl-1-(trifluoromethyl)-1,2-benziodoxole
- 3,3-Dimethyl-1-(trifluoromethyl)-1,2-benziodoxole(Togni's reagent I)
- 1,3-Dihydro-3,3-dimethyl-1-(trifluoromethyl)-1,2-benziodoxole, Tognis Reagent
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Trifluoromethyl-3,3-dimethyl-1,2-benziodoxole
CAS:Formula:C10H10F3IOPurity:>97.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:330.091-Trifluoromethyl-3,3-Dimethyl-1,2-Benziodoxole
CAS:Formula:C10H10F3IOPurity:97%Color and Shape:SolidMolecular weight:330.08553,3-Dimethyl-1-(trifluoromethyl)-1,2-benziodoxole
CAS:3,3-Dimethyl-1-(trifluoromethyl)-1,2-benziodoxoleFormula:C10H10F3IOPurity:96%Color and Shape: white crystalline powderMolecular weight:330.09g/molTrifluoromethyl-1,3-dihydro-3,3-dimethyl-1,2-benziodoxole
CAS:Formula:C10H10F3IOPurity:97%Color and Shape:PowderMolecular weight:330.089Togni’s Reagent
CAS:Controlled Product<p>Stability Moisture Sensitive<br>Applications Togni’s Reagent is used in trifluoromethylation reactions.<br>References Kieltsch, I. et al.: Angew. Chem. Int. Edit., 46, 754 (2007);<br></p>Formula:C10H10F3IOColor and Shape:NeatMolecular weight:330.09Togni's Reagent (3,3-Dimethyl-1-(trifluoromethyl)-1,2-benziodoxole) extrapure, 97%
CAS:Formula:C10H10F3IOPurity:min. 97.0%Color and Shape:White to almost white to light yellow to beige, Powder or CrystalsMolecular weight:330.09






