CymitQuimica logo

CAS 88718-32-5

:

3,4,6,7,10,11-hexahydro-2H,9H-1,5,8,12-benzotetraoxacyclotetradecine

Description:
3,4,6,7,10,11-hexahydro-2H,9H-1,5,8,12-benzotetraoxacyclotetradecine, identified by its CAS number 88718-32-5, is a complex organic compound characterized by its unique bicyclic structure that incorporates multiple oxygen atoms within its framework. This compound features a fused ring system, which contributes to its stability and potential reactivity. The presence of multiple hydrocarbon and ether-like linkages suggests that it may exhibit interesting chemical properties, including potential solubility in various organic solvents. Its molecular structure implies that it could participate in various chemical reactions, such as oxidation or reduction, depending on the functional groups present. Additionally, the compound's stereochemistry may influence its biological activity and interactions with other molecules. While specific applications or biological activities may not be widely documented, compounds of this nature often find relevance in fields such as medicinal chemistry, materials science, or as intermediates in organic synthesis. Further research would be necessary to elucidate its full range of properties and potential uses.
Formula:C14H20O4
InChI:InChI=1/C14H20O4/c1-2-6-14-13(5-1)17-9-3-7-15-11-12-16-8-4-10-18-14/h1-2,5-6H,3-4,7-12H2
Synonyms:
  • 88718-32-5
  • 2H,9H-1,5,8,16-Benzotetraoxacyclotetradecin, 3,4,6,7,10,11-hexahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.